C11H13FN2 — CID 127437089
2-(3-fluoro-2-pyridinyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 127437089) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(3-fluoro-2-pyridinyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | 2-(3-fluoro-2-pyridinyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 127437089 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-(3-fluoro-2-pyridinyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | Fc1cccnc1N1CC2CCC1C2 |
| InChI | InChI=1S/C11H13FN2/c12-10-2-1-5-13-11(10)14-7-8-3-4-9(14)6-8/h1-2,5,8-9H,3-4,6-7H2 |
| InChIKey | LYTHJGAALDKNDY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |