C19H23N5 — CID 98787854
2,3-bis[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]pyrido[2,3-b]pyrazine (PubChem CID 98787854) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2,3-bis[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]pyrido[2,3-b]pyrazine.
| Compound Name | 2,3-bis[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 98787854 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2,3-bis[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]pyrido[2,3-b]pyrazine |
| SMILES | c1cnc2nc(N3C[C@H]4CC[C@H]3C4)c(N3C[C@H]4CC[C@H]3C4)nc2c1 |
| InChI | InChI=1S/C19H23N5/c1-2-16-17(20-7-1)22-19(24-11-13-4-6-15(24)9-13)18(21-16)23-10-12-3-5-14(23)8-12/h1-2,7,12-15H,3-6,8-11H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | WUQSQQLTZRPBHL-AJNGGQMLSA-N |
| XLogP | 3.00 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |