C11H13FN2O4S — CID 114083623
4-(3-fluoro-5-nitrophenyl)-1,4-thiazepane 1,1-dioxide (PubChem CID 114083623) has the molecular formula C11H13FN2O4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(3-fluoro-5-nitrophenyl)-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-(3-fluoro-5-nitrophenyl)-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 114083623 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(3-fluoro-5-nitrophenyl)-1,4-thiazepane 1,1-dioxide |
| SMILES | O=[N+]([O-])c1cc(F)cc(N2CCCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H13FN2O4S/c12-9-6-10(8-11(7-9)14(15)16)13-2-1-4-19(17,18)5-3-13/h6-8H,1-5H2 |
| InChIKey | LDNJHAPPFNOXIG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|