C15H13FN2O3 — CID 80751905
4-(3-fluoro-5-nitrophenyl)-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 80751905) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-(3-fluoro-5-nitrophenyl)-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-(3-fluoro-5-nitrophenyl)-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 80751905 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(3-fluoro-5-nitrophenyl)-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | O=[N+]([O-])c1cc(F)cc(N2CCOc3ccccc3C2)c1 |
| InChI | InChI=1S/C15H13FN2O3/c16-12-7-13(9-14(8-12)18(19)20)17-5-6-21-15-4-2-1-3-11(15)10-17/h1-4,7-9H,5-6,10H2 |
| InChIKey | MAQMPSCUKNESRH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|