C14H27N3O — CID 114084152
N-(4-aminocyclohexyl)-3,3-dimethylpiperidine-2-carboxamide (PubChem CID 114084152) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,3-dimethylpiperidine-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-3,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114084152 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,3-dimethylpiperidine-2-carboxamide |
| SMILES | CC1(C)CCCNC1C(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C14H27N3O/c1-14(2)8-3-9-16-12(14)13(18)17-11-6-4-10(15)5-7-11/h10-12,16H,3-9,15H2,1-2H3,(H,17,18) |
| InChIKey | MAJXNHQHFKQXKG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |