C11H14FNO4S — CID 114084368
methyl 3-[(5-fluoro-3-pyridinyl)methylsulfonyl]butanoate (PubChem CID 114084368) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl 3-[(5-fluoro-3-pyridinyl)methylsulfonyl]butanoate.
| Compound Name | methyl 3-[(5-fluoro-3-pyridinyl)methylsulfonyl]butanoate |
|---|---|
| PubChem CID | 114084368 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | methyl 3-[(5-fluoro-3-pyridinyl)methylsulfonyl]butanoate |
| SMILES | COC(=O)CC(C)S(=O)(=O)Cc1cncc(F)c1 |
| InChI | InChI=1S/C11H14FNO4S/c1-8(3-11(14)17-2)18(15,16)7-9-4-10(12)6-13-5-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | DJDAXZHADWZEHI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |