C15H15ClFNO — CID 114084526
3-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-5-fluoropyridine (PubChem CID 114084526) has the molecular formula C15H15ClFNO and a molecular weight of 279.74 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-5-fluoropyridine.
| Compound Name | 3-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-5-fluoropyridine |
|---|---|
| PubChem CID | 114084526 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-5-fluoropyridine |
| SMILES | Cc1cc(CCl)cc(C)c1OCc1cncc(F)c1 |
| InChI | InChI=1S/C15H15ClFNO/c1-10-3-12(6-16)4-11(2)15(10)19-9-13-5-14(17)8-18-7-13/h3-5,7-8H,6,9H2,1-2H3 |
| InChIKey | LQHSSINSRLOWHZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|