C14H22ClN3 — CID 114086305
3-chloro-2-[(2,4-dimethyl-1,4-diazepan-1-yl)methyl]aniline (PubChem CID 114086305) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-chloro-2-[(2,4-dimethyl-1,4-diazepan-1-yl)methyl]aniline.
| Compound Name | 3-chloro-2-[(2,4-dimethyl-1,4-diazepan-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 114086305 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-chloro-2-[(2,4-dimethyl-1,4-diazepan-1-yl)methyl]aniline |
| SMILES | CC1CN(C)CCCN1Cc1c(N)cccc1Cl |
| InChI | InChI=1S/C14H22ClN3/c1-11-9-17(2)7-4-8-18(11)10-12-13(15)5-3-6-14(12)16/h3,5-6,11H,4,7-10,16H2,1-2H3 |
| InChIKey | DLDLUWZUPLBCER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|