About [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine
[3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine (PubChem CID 114087664) has the molecular formula C13H21ClN4
and a molecular weight of 268.79 g/mol. Its IUPAC name is [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine |
| PubChem CID | 114087664 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine |
| SMILES | CC1CN(C)CCCN1c1ccc(Cl)c(CN)n1 |
| InChI | InChI=1S/C13H21ClN4/c1-10-9-17(2)6-3-7-18(10)13-5-4-11(14)12(8-15)16-13/h4-5,10H,3,6-9,15H2,1-2H3 |
| InChIKey | MFBCUSWAAUBUBA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine?
The IUPAC name of [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine (CID 114087664) is [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine.
What is the SMILES notation for [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine?
The canonical SMILES for [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine is CC1CN(C)CCCN1c1ccc(Cl)c(CN)n1.
What is the InChIKey of [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine?
The InChIKey is MFBCUSWAAUBUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN4/c1-10-9-17(2)6-3-7-18(10)13-5-4-11(14)12(8-15)16-13/h4-5,10H,3,6-9,15H2,1-2H3.
What are the key properties of [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine?
[3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine has a molecular weight of 268.79 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-6-(2,4-dimethyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine is sourced from PubChem (CID 114087664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).