C14H19ClN2O — CID 114087211
2-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)benzaldehyde (PubChem CID 114087211) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 2-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)benzaldehyde.
| Compound Name | 2-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 114087211 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)benzaldehyde |
| SMILES | CC1CN(C)CCCN1c1ccc(C=O)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O/c1-11-9-16(2)6-3-7-17(11)13-5-4-12(10-18)14(15)8-13/h4-5,8,10-11H,3,6-7,9H2,1-2H3 |
| InChIKey | XVMAZAYLOPUEMF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|