C17H28N2 — CID 170570052
(2S)-1-(3-ethyl-4-propan-2-ylphenyl)-2,4-dimethylpiperazine (PubChem CID 170570052) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (2S)-1-(3-ethyl-4-propan-2-ylphenyl)-2,4-dimethylpiperazine.
| Compound Name | (2S)-1-(3-ethyl-4-propan-2-ylphenyl)-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 170570052 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (2S)-1-(3-ethyl-4-propan-2-ylphenyl)-2,4-dimethylpiperazine |
| SMILES | CCc1cc(N2CCN(C)C[C@@H]2C)ccc1C(C)C |
| InChI | InChI=1S/C17H28N2/c1-6-15-11-16(7-8-17(15)13(2)3)19-10-9-18(5)12-14(19)4/h7-8,11,13-14H,6,9-10,12H2,1-5H3/t14-/m0/s1 |
| InChIKey | MKHOOFGHBAKWGC-AWEZNQCLSA-N |
| XLogP | 3.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|