C10H12N4O4 — CID 114090038
(2-amino-5-nitro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone (PubChem CID 114090038) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is (2-amino-5-nitro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone.
| Compound Name | (2-amino-5-nitro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 114090038 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2-amino-5-nitro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCC(O)C2)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H12N4O4/c11-9-3-7(8(4-12-9)14(17)18)10(16)13-2-1-6(15)5-13/h3-4,6,15H,1-2,5H2,(H2,11,12) |
| InChIKey | LEWTWFNHVYTCOX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|