C29H46O4Si — CID 11409158
(2R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-12-phenylmethoxydodec-2-enyl]-2H-furan-5-one (PubChem CID 11409158) has the molecular formula C29H46O4Si and a molecular weight of 486.77 g/mol. Its IUPAC name is (2R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-12-phenylmethoxydodec-2-enyl]-2H-furan-5-one.
| Compound Name | (2R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-12-phenylmethoxydodec-2-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 11409158 |
| Molecular Formula | C29H46O4Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (2R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-12-phenylmethoxydodec-2-enyl]-2H-furan-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/CCCCCCCCCOCc1ccccc1)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C29H46O4Si/c1-29(2,3)34(4,5)33-27(26-21-22-28(30)32-26)20-16-11-9-7-6-8-10-12-17-23-31-24-25-18-14-13-15-19-25/h13-16,18-22,26-27H,6-12,17,23-24H2,1-5H3/b20-16+/t26-,27-/m1/s1 |
| InChIKey | BMSMYOVIUAKDBH-PHLSORPBSA-N |
| XLogP | 7.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|