C21H26O2 — CID 122662622
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-phenyl-2H-furan-5-one (PubChem CID 122662622) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-phenyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-phenyl-2H-furan-5-one |
|---|---|
| PubChem CID | 122662622 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-phenyl-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C21H26O2/c1-16(2)9-7-10-17(3)11-8-14-19-15-20(23-21(19)22)18-12-5-4-6-13-18/h4-6,9,11-13,15,20H,7-8,10,14H2,1-3H3/b17-11+/t20-/m1/s1 |
| InChIKey | YANVIRLIOADWFE-FVECTHPASA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|