C23H21BrClN3O2 — CID 11409159
3-[[2-(2-bromophenyl)-2-(2-chloro-4-methylanilino)acetyl]amino]-N-methylbenzamide (PubChem CID 11409159) has the molecular formula C23H21BrClN3O2 and a molecular weight of 486.80 g/mol. Its IUPAC name is 3-[[2-(2-bromophenyl)-2-(2-chloro-4-methylanilino)acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-(2-bromophenyl)-2-(2-chloro-4-methylanilino)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 11409159 |
| Molecular Formula | C23H21BrClN3O2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 3-[[2-(2-bromophenyl)-2-(2-chloro-4-methylanilino)acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C(Nc2ccc(C)cc2Cl)c2ccccc2Br)c1 |
| InChI | InChI=1S/C23H21BrClN3O2/c1-14-10-11-20(19(25)12-14)28-21(17-8-3-4-9-18(17)24)23(30)27-16-7-5-6-15(13-16)22(29)26-2/h3-13,21,28H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | LGHYPXFASNVEFE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |