C21H18BrCl2N3O — CID 10254516
2-(2-bromophenyl)-2-(2,4-dichloroanilino)-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 10254516) has the molecular formula C21H18BrCl2N3O and a molecular weight of 479.21 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-(2,4-dichloroanilino)-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(2-bromophenyl)-2-(2,4-dichloroanilino)-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 10254516 |
| Molecular Formula | C21H18BrCl2N3O |
| Molecular Weight | 479.21 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | 2-(2-bromophenyl)-2-(2,4-dichloroanilino)-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | O=C(NCCc1ccncc1)C(Nc1ccc(Cl)cc1Cl)c1ccccc1Br |
| InChI | InChI=1S/C21H18BrCl2N3O/c22-17-4-2-1-3-16(17)20(27-19-6-5-15(23)13-18(19)24)21(28)26-12-9-14-7-10-25-11-8-14/h1-8,10-11,13,20,27H,9,12H2,(H,26,28) |
| InChIKey | XNCGOHPFOUXBTL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.21 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |