C24H24ClN3O — CID 11384204
2-(2-chloro-4-methylanilino)-2-(2-ethenylphenyl)-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 11384204) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 2-(2-chloro-4-methylanilino)-2-(2-ethenylphenyl)-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(2-chloro-4-methylanilino)-2-(2-ethenylphenyl)-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 11384204 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-(2-chloro-4-methylanilino)-2-(2-ethenylphenyl)-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | C=Cc1ccccc1C(Nc1ccc(C)cc1Cl)C(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C24H24ClN3O/c1-3-19-6-4-5-7-20(19)23(28-22-9-8-17(2)16-21(22)25)24(29)27-15-12-18-10-13-26-14-11-18/h3-11,13-14,16,23,28H,1,12,15H2,2H3,(H,27,29) |
| InChIKey | XLXIVHLJANQKSW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |