C30H26ClN3O2 — CID 162396341
2-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)prop-2-enamide (PubChem CID 162396341) has the molecular formula C30H26ClN3O2 and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)prop-2-enamide.
| Compound Name | 2-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 162396341 |
| Molecular Formula | C30H26ClN3O2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)N(c1ccc(-c2ccccc2)cc1)C(C(=O)N[C@@H](C)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C30H26ClN3O2/c1-21(31)30(36)34(27-17-15-25(16-18-27)24-12-7-4-8-13-24)28(26-14-9-19-32-20-26)29(35)33-22(2)23-10-5-3-6-11-23/h3-20,22,28H,1H2,2H3,(H,33,35)/t22-,28?/m0/s1 |
| InChIKey | MHJPHUFUJGFFSH-XYXHBKGXSA-N |
| XLogP | 6.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|