C31H29Cl2N3O2 — CID 162396347
(2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(2S)-4-phenylbutan-2-yl]-2-pyridin-3-ylacetamide (PubChem CID 162396347) has the molecular formula C31H29Cl2N3O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(2S)-4-phenylbutan-2-yl]-2-pyridin-3-ylacetamide.
| Compound Name | (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(2S)-4-phenylbutan-2-yl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 162396347 |
| Molecular Formula | C31H29Cl2N3O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(2S)-4-phenylbutan-2-yl]-2-pyridin-3-ylacetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)[C@@H](c1cccnc1)N(C(=O)C(Cl)Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29Cl2N3O2/c1-22(14-15-23-9-4-2-5-10-23)35-30(37)28(26-13-8-20-34-21-26)36(31(38)29(32)33)27-18-16-25(17-19-27)24-11-6-3-7-12-24/h2-13,16-22,28-29H,14-15H2,1H3,(H,35,37)/t22-,28+/m0/s1 |
| InChIKey | OPDVPTDPNBPSNI-RBISFHTESA-N |
| XLogP | 6.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|