C32H29N3O4 — CID 177371538
methyl (E)-4-oxo-4-(N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-4-phenylanilino)but-2-enoate (PubChem CID 177371538) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-(N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-4-phenylanilino)but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-(N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-4-phenylanilino)but-2-enoate |
|---|---|
| PubChem CID | 177371538 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | methyl (E)-4-oxo-4-(N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-4-phenylanilino)but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)N(c1ccc(-c2ccccc2)cc1)C(C(=O)N[C@@H](C)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C32H29N3O4/c1-23(24-10-5-3-6-11-24)34-32(38)31(27-14-9-21-33-22-27)35(29(36)19-20-30(37)39-2)28-17-15-26(16-18-28)25-12-7-4-8-13-25/h3-23,31H,1-2H3,(H,34,38)/b20-19+/t23-,31?/m0/s1 |
| InChIKey | SHRYBFGXRROFFT-WTHGOZCHSA-N |
| XLogP | 5.43 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|