C29H24BrCl2N3O2 — CID 162396354
2-bromo-2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide (PubChem CID 162396354) has the molecular formula C29H24BrCl2N3O2 and a molecular weight of 597.34 g/mol. Its IUPAC name is 2-bromo-2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-bromo-2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 162396354 |
| Molecular Formula | C29H24BrCl2N3O2 |
| Molecular Weight | 597.34 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 2-bromo-2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide |
| SMILES | C[C@H](NC(=O)C(c1cccnc1)N(C(=O)C(Cl)(Cl)Br)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H24BrCl2N3O2/c1-20(21-9-4-2-5-10-21)34-27(36)26(24-13-8-18-33-19-24)35(28(37)29(30,31)32)25-16-14-23(15-17-25)22-11-6-3-7-12-22/h2-20,26H,1H3,(H,34,36)/t20-,26?/m0/s1 |
| InChIKey | GIBRBJXGWFHBTB-DQUNLGLBSA-N |
| XLogP | 7.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.34 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|