C29H26N6O2 — CID 162396327
2-(N-(2-azidoacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide (PubChem CID 162396327) has the molecular formula C29H26N6O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-(N-(2-azidoacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide.
| Compound Name | 2-(N-(2-azidoacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 162396327 |
| Molecular Formula | C29H26N6O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-(N-(2-azidoacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide |
| SMILES | C[C@H](NC(=O)C(c1cccnc1)N(C(=O)CN=[N+]=[N-])c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N6O2/c1-21(22-9-4-2-5-10-22)33-29(37)28(25-13-8-18-31-19-25)35(27(36)20-32-34-30)26-16-14-24(15-17-26)23-11-6-3-7-12-23/h2-19,21,28H,20H2,1H3,(H,33,37)/t21-,28?/m0/s1 |
| InChIKey | GEYTVBNZOHWYQI-QDLLFRBVSA-N |
| XLogP | 6.01 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|