C30H27Cl2N3O2 — CID 162396351
2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)propanamide (PubChem CID 162396351) has the molecular formula C30H27Cl2N3O2 and a molecular weight of 532.47 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)propanamide.
| Compound Name | 2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 162396351 |
| Molecular Formula | C30H27Cl2N3O2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2,2-dichloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)propanamide |
| SMILES | C[C@H](NC(=O)C(c1cccnc1)N(C(=O)C(C)(Cl)Cl)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H27Cl2N3O2/c1-21(22-10-5-3-6-11-22)34-28(36)27(25-14-9-19-33-20-25)35(29(37)30(2,31)32)26-17-15-24(16-18-26)23-12-7-4-8-13-23/h3-21,27H,1-2H3,(H,34,36)/t21-,27?/m0/s1 |
| InChIKey | QTAHNBMTSOYJDB-LWAJAQLZSA-N |
| XLogP | 6.89 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|