C29H25Cl2N3O2 — CID 162396343
(2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide (PubChem CID 162396343) has the molecular formula C29H25Cl2N3O2 and a molecular weight of 518.44 g/mol. Its IUPAC name is (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide.
| Compound Name | (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 162396343 |
| Molecular Formula | C29H25Cl2N3O2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (2R)-2-(N-(2,2-dichloroacetyl)-4-phenylanilino)-N-[(1S)-1-phenylethyl]-2-pyridin-3-ylacetamide |
| SMILES | C[C@H](NC(=O)[C@@H](c1cccnc1)N(C(=O)C(Cl)Cl)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H25Cl2N3O2/c1-20(21-9-4-2-5-10-21)33-28(35)26(24-13-8-18-32-19-24)34(29(36)27(30)31)25-16-14-23(15-17-25)22-11-6-3-7-12-22/h2-20,26-27H,1H3,(H,33,35)/t20-,26+/m0/s1 |
| InChIKey | LEOCNIZCHQOMFL-RXFWQSSRSA-N |
| XLogP | 6.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|