C10H13F3N2O2 — CID 114093691
3-[(6-ethoxy-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 114093691) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 3-[(6-ethoxy-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(6-ethoxy-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 114093691 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-[(6-ethoxy-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCOc1cccc(NCC(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O2/c1-2-17-9-5-3-4-8(15-9)14-6-7(16)10(11,12)13/h3-5,7,16H,2,6H2,1H3,(H,14,15) |
| InChIKey | CSGFJHCJRUMSTC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |