C12H15ClN2O3 — CID 114093940
6-chloro-2-[[1-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid (PubChem CID 114093940) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 6-chloro-2-[[1-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[[1-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114093940 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-chloro-2-[[1-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1NC1(CO)CCCC1 |
| InChI | InChI=1S/C12H15ClN2O3/c13-9-4-3-8(11(17)18)10(14-9)15-12(7-16)5-1-2-6-12/h3-4,16H,1-2,5-7H2,(H,14,15)(H,17,18) |
| InChIKey | CIMFHPBPDVQWQT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|