C9H11ClN2O2 — CID 63376973
6-chloro-2-(propan-2-ylamino)pyridine-3-carboxylic acid (PubChem CID 63376973) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 6-chloro-2-(propan-2-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(propan-2-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63376973 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 6-chloro-2-(propan-2-ylamino)pyridine-3-carboxylic acid |
| SMILES | CC(C)Nc1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C9H11ClN2O2/c1-5(2)11-8-6(9(13)14)3-4-7(10)12-8/h3-5H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | GYRKLKAIUVXRPR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|