C9H11ClN2O4 — CID 65313622
6-chloro-2-(1,3-dihydroxypropan-2-ylamino)pyridine-3-carboxylic acid (PubChem CID 65313622) has the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. Its IUPAC name is 6-chloro-2-(1,3-dihydroxypropan-2-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(1,3-dihydroxypropan-2-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 65313622 |
| Molecular Formula | C9H11ClN2O4 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 6-chloro-2-(1,3-dihydroxypropan-2-ylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1NC(CO)CO |
| InChI | InChI=1S/C9H11ClN2O4/c10-7-2-1-6(9(15)16)8(12-7)11-5(3-13)4-14/h1-2,5,13-14H,3-4H2,(H,11,12)(H,15,16) |
| InChIKey | HEKHBWRNSZEYMC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|