C12H5ClF4N2O2 — CID 107645109
6-chloro-2-(2,3,5,6-tetrafluoroanilino)pyridine-3-carboxylic acid (PubChem CID 107645109) has the molecular formula C12H5ClF4N2O2 and a molecular weight of 320.63 g/mol. Its IUPAC name is 6-chloro-2-(2,3,5,6-tetrafluoroanilino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(2,3,5,6-tetrafluoroanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 107645109 |
| Molecular Formula | C12H5ClF4N2O2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 6-chloro-2-(2,3,5,6-tetrafluoroanilino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H5ClF4N2O2/c13-7-2-1-4(12(20)21)11(18-7)19-10-8(16)5(14)3-6(15)9(10)17/h1-3H,(H,18,19)(H,20,21) |
| InChIKey | FXOMKYSTAAIIRS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|