C12H7Cl2IN2O2 — CID 107636188
6-chloro-2-(4-chloro-2-iodoanilino)pyridine-3-carboxylic acid (PubChem CID 107636188) has the molecular formula C12H7Cl2IN2O2 and a molecular weight of 409.01 g/mol. Its IUPAC name is 6-chloro-2-(4-chloro-2-iodoanilino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(4-chloro-2-iodoanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 107636188 |
| Molecular Formula | C12H7Cl2IN2O2 |
| Molecular Weight | 409.01 g/mol |
| Exact Mass | 407.89 |
| IUPAC Name | 6-chloro-2-(4-chloro-2-iodoanilino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C12H7Cl2IN2O2/c13-6-1-3-9(8(15)5-6)16-11-7(12(18)19)2-4-10(14)17-11/h1-5H,(H,16,17)(H,18,19) |
| InChIKey | YJPIXFUDPRLXBY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|