C13H10Cl2N2O2S — CID 155300840
6-chloro-2-(3-chloro-2-methylsulfanylanilino)pyridine-3-carboxylic acid (PubChem CID 155300840) has the molecular formula C13H10Cl2N2O2S and a molecular weight of 329.21 g/mol. Its IUPAC name is 6-chloro-2-(3-chloro-2-methylsulfanylanilino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(3-chloro-2-methylsulfanylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155300840 |
| Molecular Formula | C13H10Cl2N2O2S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 6-chloro-2-(3-chloro-2-methylsulfanylanilino)pyridine-3-carboxylic acid |
| SMILES | CSc1c(Cl)cccc1Nc1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C13H10Cl2N2O2S/c1-20-11-8(14)3-2-4-9(11)16-12-7(13(18)19)5-6-10(15)17-12/h2-6H,1H3,(H,16,17)(H,18,19) |
| InChIKey | PVTAKCIMHGWSQE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|