C11H17F2N3O — CID 114094092
1,1-difluoro-3-[[2-(propylamino)-4-pyridinyl]amino]propan-2-ol (PubChem CID 114094092) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is 1,1-difluoro-3-[[2-(propylamino)-4-pyridinyl]amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[[2-(propylamino)-4-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 114094092 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1,1-difluoro-3-[[2-(propylamino)-4-pyridinyl]amino]propan-2-ol |
| SMILES | CCCNc1cc(NCC(O)C(F)F)ccn1 |
| InChI | InChI=1S/C11H17F2N3O/c1-2-4-14-10-6-8(3-5-15-10)16-7-9(17)11(12)13/h3,5-6,9,11,17H,2,4,7H2,1H3,(H2,14,15,16) |
| InChIKey | DKUJMADUSPPEHE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |