C11H20N4O2S — CID 113367731
3-[[2-(propylamino)-4-pyridinyl]amino]propane-1-sulfonamide (PubChem CID 113367731) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[[2-(propylamino)-4-pyridinyl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[2-(propylamino)-4-pyridinyl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113367731 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[[2-(propylamino)-4-pyridinyl]amino]propane-1-sulfonamide |
| SMILES | CCCNc1cc(NCCCS(N)(=O)=O)ccn1 |
| InChI | InChI=1S/C11H20N4O2S/c1-2-5-14-11-9-10(4-7-15-11)13-6-3-8-18(12,16)17/h4,7,9H,2-3,5-6,8H2,1H3,(H2,12,16,17)(H2,13,14,15) |
| InChIKey | DIZQRBBKWOIHMW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|