C30H29NO6 — CID 11409418
(E)-3-phenyl-1-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]prop-2-en-1-one (PubChem CID 11409418) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is (E)-3-phenyl-1-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11409418 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (E)-3-phenyl-1-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CO[C@@H]2[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C30H29NO6/c32-25(17-16-21-10-4-1-5-11-21)31-20-35-28-26(31)30(33-18-22-12-6-2-7-13-22)36-24-19-34-29(37-27(24)28)23-14-8-3-9-15-23/h1-17,24,26-30H,18-20H2/b17-16+/t24-,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | ZUHWRUQVLWKVHK-BSZSAJMCSA-N |
| XLogP | 4.31 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|