C12H21F2NO2 — CID 114094448
3,3-difluoro-N-(5-hydroxy-4-methylpentyl)cyclopentane-1-carboxamide (PubChem CID 114094448) has the molecular formula C12H21F2NO2 and a molecular weight of 249.30 g/mol. Its IUPAC name is 3,3-difluoro-N-(5-hydroxy-4-methylpentyl)cyclopentane-1-carboxamide.
| Compound Name | 3,3-difluoro-N-(5-hydroxy-4-methylpentyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114094448 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3,3-difluoro-N-(5-hydroxy-4-methylpentyl)cyclopentane-1-carboxamide |
| SMILES | CC(CO)CCCNC(=O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C12H21F2NO2/c1-9(8-16)3-2-6-15-11(17)10-4-5-12(13,14)7-10/h9-10,16H,2-8H2,1H3,(H,15,17) |
| InChIKey | OKDQKRWPXMJTDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|