C14H21N3S — CID 114097253
N-methyl-3-[5-(3-tricyclo[3.2.1.02,4]octanyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 114097253) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-methyl-3-[5-(3-tricyclo[3.2.1.02,4]octanyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(3-tricyclo[3.2.1.02,4]octanyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 114097253 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-methyl-3-[5-(3-tricyclo[3.2.1.02,4]octanyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1nnc(C2C3C4CCC(C4)C23)s1 |
| InChI | InChI=1S/C14H21N3S/c1-15-6-2-3-10-16-17-14(18-10)13-11-8-4-5-9(7-8)12(11)13/h8-9,11-13,15H,2-7H2,1H3 |
| InChIKey | CJEMMSZXACHQQC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|