C15H27N3S — CID 107185508
3-[5-(2,2-dimethylcyclopentyl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine (PubChem CID 107185508) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylcyclopentyl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine.
| Compound Name | 3-[5-(2,2-dimethylcyclopentyl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 107185508 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-[5-(2,2-dimethylcyclopentyl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
| SMILES | CCCNCCCc1nnc(C2CCCC2(C)C)s1 |
| InChI | InChI=1S/C15H27N3S/c1-4-10-16-11-6-8-13-17-18-14(19-13)12-7-5-9-15(12,2)3/h12,16H,4-11H2,1-3H3 |
| InChIKey | GKKOCOJKLYQMLJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|