C16H21N3S2 — CID 79211742
3-[5-(2,3-dihydro-1-benzothiophen-3-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine (PubChem CID 79211742) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 3-[5-(2,3-dihydro-1-benzothiophen-3-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine.
| Compound Name | 3-[5-(2,3-dihydro-1-benzothiophen-3-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79211742 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[5-(2,3-dihydro-1-benzothiophen-3-yl)-1,3,4-thiadiazol-2-yl]-N-propylpropan-1-amine |
| SMILES | CCCNCCCc1nnc(C2CSc3ccccc32)s1 |
| InChI | InChI=1S/C16H21N3S2/c1-2-9-17-10-5-8-15-18-19-16(21-15)13-11-20-14-7-4-3-6-12(13)14/h3-4,6-7,13,17H,2,5,8-11H2,1H3 |
| InChIKey | BEBOFEBNXJXESC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|