C10H7IN2S2 — CID 79212094
2-(2,3-dihydro-1-benzothiophen-3-yl)-5-iodo-1,3,4-thiadiazole (PubChem CID 79212094) has the molecular formula C10H7IN2S2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-yl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-yl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 79212094 |
| Molecular Formula | C10H7IN2S2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.91 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-yl)-5-iodo-1,3,4-thiadiazole |
| SMILES | Ic1nnc(C2CSc3ccccc32)s1 |
| InChI | InChI=1S/C10H7IN2S2/c11-10-13-12-9(15-10)7-5-14-8-4-2-1-3-6(7)8/h1-4,7H,5H2 |
| InChIKey | HRHPFHLYOILSIS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|