C13H14N4S — CID 79213852
3-(2,3-dihydro-1-benzothiophen-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 79213852) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzothiophen-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(2,3-dihydro-1-benzothiophen-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 79213852 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(2,3-dihydro-1-benzothiophen-3-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | c1ccc2c(c1)SCC2c1nnc2n1CCNC2 |
| InChI | InChI=1S/C13H14N4S/c1-2-4-11-9(3-1)10(8-18-11)13-16-15-12-7-14-5-6-17(12)13/h1-4,10,14H,5-8H2 |
| InChIKey | SBLXWWDALXUKJU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |