C16H19F2N5O2S — CID 120825584
3-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120825584) has the molecular formula C16H19F2N5O2S and a molecular weight of 383.42 g/mol. Its IUPAC name is 3-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120825584 |
| Molecular Formula | C16H19F2N5O2S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C16H19F2N5O2S/c17-12-2-1-3-13(18)15(12)26(24,25)22-7-4-11(5-8-22)16-21-20-14-10-19-6-9-23(14)16/h1-3,11,19H,4-10H2 |
| InChIKey | HTCDASGIXDHZQJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |