C18H23N5O3S — CID 120825676
3-[1-(1,3-dihydro-2-benzofuran-5-ylsulfonyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120825676) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-[1-(1,3-dihydro-2-benzofuran-5-ylsulfonyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-(1,3-dihydro-2-benzofuran-5-ylsulfonyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120825676 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[1-(1,3-dihydro-2-benzofuran-5-ylsulfonyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | O=S(=O)(c1ccc2c(c1)COC2)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C18H23N5O3S/c24-27(25,16-2-1-14-11-26-12-15(14)9-16)22-6-3-13(4-7-22)18-21-20-17-10-19-5-8-23(17)18/h1-2,9,13,19H,3-8,10-12H2 |
| InChIKey | MJONHPJLVSJBNS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |