C16H20Cl2FN5O2S — CID 120825775
3-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120825775) has the molecular formula C16H20Cl2FN5O2S and a molecular weight of 436.34 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120825775 |
| Molecular Formula | C16H20Cl2FN5O2S |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 3-[1-(3-chloro-2-fluorophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(Cl)c1F)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C16H19ClFN5O2S.ClH/c17-12-2-1-3-13(15(12)18)26(24,25)22-7-4-11(5-8-22)16-21-20-14-10-19-6-9-23(14)16;/h1-3,11,19H,4-10H2;1H |
| InChIKey | KRXLXILZMDGWSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |