C17H23Cl2N5O2S — CID 120825697
3-[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120825697) has the molecular formula C17H23Cl2N5O2S and a molecular weight of 432.38 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120825697 |
| Molecular Formula | C17H23Cl2N5O2S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCC(c2nnc3n2CCNC3)CC1.Cl |
| InChI | InChI=1S/C17H22ClN5O2S.ClH/c1-12-14(18)3-2-4-15(12)26(24,25)22-8-5-13(6-9-22)17-21-20-16-11-19-7-10-23(16)17;/h2-4,13,19H,5-11H2,1H3;1H |
| InChIKey | VRCPKJTWGBXDLG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |