C17H21F2N5O2S — CID 138001812
3-[1-[(2,3-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 138001812) has the molecular formula C17H21F2N5O2S and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[1-[(2,3-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-[(2,3-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 138001812 |
| Molecular Formula | C17H21F2N5O2S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-[1-[(2,3-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | O=S(=O)(Cc1cccc(F)c1F)N1CCC(c2nnc3n2CCNC3)CC1 |
| InChI | InChI=1S/C17H21F2N5O2S/c18-14-3-1-2-13(16(14)19)11-27(25,26)23-7-4-12(5-8-23)17-22-21-15-10-20-6-9-24(15)17/h1-3,12,20H,4-11H2 |
| InChIKey | LDRCFFCZABVFEE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |