C16H20N6O4S — CID 120825792
3-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 120825792) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 3-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 120825792 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC(c3nnc4n3CCNC4)CC2)cc1 |
| InChI | InChI=1S/C16H20N6O4S/c23-22(24)13-1-3-14(4-2-13)27(25,26)20-8-5-12(6-9-20)16-19-18-15-11-17-7-10-21(15)16/h1-4,12,17H,5-11H2 |
| InChIKey | JRMNUXOYZMJCFN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|