C17H22ClFN6O2 — CID 120826134
3-[1-[(2-fluoro-4-nitrophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120826134) has the molecular formula C17H22ClFN6O2 and a molecular weight of 396.85 g/mol. Its IUPAC name is 3-[1-[(2-fluoro-4-nitrophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-[(2-fluoro-4-nitrophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120826134 |
| Molecular Formula | C17H22ClFN6O2 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[1-[(2-fluoro-4-nitrophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CN2CCC(c3nnc4n3CCNC4)CC2)c(F)c1 |
| InChI | InChI=1S/C17H21FN6O2.ClH/c18-15-9-14(24(25)26)2-1-13(15)11-22-6-3-12(4-7-22)17-21-20-16-10-19-5-8-23(16)17;/h1-2,9,12,19H,3-8,10-11H2;1H |
| InChIKey | QAXHTUSZHHLAME-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|