C14H23NO2 — CID 114099391
N-[(2-ethylphenyl)methyl]-2,3-dimethoxypropan-1-amine (PubChem CID 114099391) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-[(2-ethylphenyl)methyl]-2,3-dimethoxypropan-1-amine.
| Compound Name | N-[(2-ethylphenyl)methyl]-2,3-dimethoxypropan-1-amine |
|---|---|
| PubChem CID | 114099391 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[(2-ethylphenyl)methyl]-2,3-dimethoxypropan-1-amine |
| SMILES | CCc1ccccc1CNCC(COC)OC |
| InChI | InChI=1S/C14H23NO2/c1-4-12-7-5-6-8-13(12)9-15-10-14(17-3)11-16-2/h5-8,14-15H,4,9-11H2,1-3H3 |
| InChIKey | NKAYLROJKAJFQP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |