C30H62O3Si3 — CID 11410310
(2S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-yn-3-one (PubChem CID 11410310) has the molecular formula C30H62O3Si3 and a molecular weight of 555.08 g/mol. Its IUPAC name is (2S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-yn-3-one.
| Compound Name | (2S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-yn-3-one |
|---|---|
| PubChem CID | 11410310 |
| Molecular Formula | C30H62O3Si3 |
| Molecular Weight | 555.08 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | (2S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-triethylsilyloxy-8-tri(propan-2-yl)silyloct-7-yn-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H](CC#C[Si](C(C)C)(C(C)C)C(C)C)CC(=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O3Si3/c1-16-35(17-2,18-3)33-28(20-19-21-36(24(4)5,25(6)7)26(8)9)22-29(31)27(10)23-32-34(14,15)30(11,12)13/h24-28H,16-18,20,22-23H2,1-15H3/t27-,28+/m0/s1 |
| InChIKey | LSEVIUPVFXLHEP-WUFINQPMSA-N |
| XLogP | 9.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.08 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|