C23H46O3Si2 — CID 10598557
(4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynal (PubChem CID 10598557) has the molecular formula C23H46O3Si2 and a molecular weight of 426.79 g/mol. Its IUPAC name is (4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynal.
| Compound Name | (4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynal |
|---|---|
| PubChem CID | 10598557 |
| Molecular Formula | C23H46O3Si2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynal |
| SMILES | C[C@@H](CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C#CC=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O3Si2/c1-19(18-25-27(9,10)22(3,4)5)15-16-21(20(2)14-13-17-24)26-28(11,12)23(6,7)8/h17,19-21H,15-16,18H2,1-12H3/t19-,20+,21-/m0/s1 |
| InChIKey | NAHSPPRPTMJGGN-HBMCJLEFSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|